Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Cysteinesulfonic acid
PubChem ID:72886
Pathway:Show KEGG pathways
InChI:InChI=1/C3H7NO5S/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/t2-/m0/s1/f/h5,7H
SMILES:C([C@@H](C(O)=O)N)S(O)(=O)=O

Properties:
Formula:C3H7NO5SAtoms:10
Molecular Weight:169.156Rotatable Bonds:3
H-bond Acceptors:6H-bond Donors:0
logP:0.0672
Targets:
Synonyms:
(2R)-2-amino-3-sulfopropanoic acid
13100-82-8
2-amino-3-sulfopropanoic acid
2-Amino-3-sulfopropionic acid
23537-25-9
3-sulfo-l-alanin
3-Sulfoalanine
498-40-8
AC1L2IVW
AC1Q4U92
AC1Q5QN5
AIDS-018785
AIDS018785
Alanine, 3-sulfo-, L-
Alanine, 3-sulfo-, L- (8CI)
alpha-amino-beta-sulfopropionic acid
Ambap4643
Ambap498-40-8
AR-1F5222
bmse000380
C00506
Cepteic acid
CHEBI:17285
CHEMBL1234939
Cipteic acid
Cysteic acid (VAN)
Cysteinesulfonic acid
Cysteinic acid
Cysteric acid
DB03661
EINECS 207-861-3
L-alanine, 3-sulfo-
L-Alanine, 3-sulfo- (9CI)
L-Cysteate
L-Cysteic acid
L-Cysteic Acid Hydrate
MolPort-001-792-490
NSC 254030
OCS
ST079666