Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Chromoflavine
PubChem ID:6842
Pathway:Show KEGG pathways
InChI:InChI=1/C14H13N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;/h2-8H,1H3,(H3,15,16);1H/fC14H14N3.Cl/h15-16H2;1h/q+1;-1
SMILES:C[n+]1c2cc(ccc2cc2ccc(cc12)N)N.[Cl-]

Properties:
Formula:C14H14ClN3Atoms:18
Molecular Weight:259.734Rotatable Bonds:0
H-bond Acceptors:2H-bond Donors:0
logP:0.1483
Targets:
Synonyms:
10-methylacridin-10-ium-3,6-diamine chloride
2,8-Diamino-10-methylacridinium chloride
3,6-DIAMINO-10-METHYLACRIDINIUM CHLORIDE
8048-52-0
837-73-0
837-73-0 (Parent)
86-40-8
AC1L1NFA
AC1LD8LF
AC1Q1RWW
Acridinium, 3,6-diamino-10-methyl-, chloride
Acridinium, 3,6-diamino-10-methyl-, chloride (1:1)
Acriflavine
Acriflavine (component of)
Acriflavine neutral
Acriflavinium chloride
ACRIFLAVINIUM HYDROCHLORIDE
Acriflavon
AF
AR-1E9943
Avlon
Burnol
C.I. 46000
CCG-39873
CCRIS 2116
CHEBI:383703
CHEMBL354349
Chromoflavine
EINECS 201-668-8
Flavin
Flavine
Flavosan
Gonacrine
Gonocrin
HMS1921K15
HMS2092E08
HMS500M06
LS-14522
MLS002207308
NCGC00094813-01
NCGC00094813-02
Neutroflavine
NSC 2755
NSC2755
NSC47700
Panflavin
SBB003092
SMR001306813
SPECTRUM1500618
Trypaflavin
UNII-1T3A50395T
UNII-1TW3Q60E36
WLN: T C666 BKJ B1 EZ MZ &Q &G
Xanthacridine