Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:AC1O585S
PubChem ID:6479612
Pathway:Show KEGG pathways
InChI:InChI=1S/C17H11N5O8/c23-15-10(17(25)26)4-1-8-2-5-12(18-14(8)15)16(24)20-19-11-6-3-9(21(27)28)7-13(11)22(29)30/h1-7,19,23H,(H,20,24)(H,25,26)
SMILES:O=C(c1ccc2c(n1)c(O)c(cc2)C(=O)O)NNc1ccc(cc1[N+](=O)[O-])[N+](=O)[O-]

Properties:
Formula:C17H11N5O8Atoms:30
Molecular Weight:413.298Rotatable Bonds:7
H-bond Acceptors:7H-bond Donors:4
logP:3.7222
Targets:
Synonyms:
()-oxazepam hemisuccinate sodium salt
2-[(2,4-dinitroanilino)carbamoyl]-8-hydroxyquinoline-7-carboxylic acid
2-{[2-(2,4-Dinitrophenyl)hydrazino]carbonyl}-8-hydroxyquinoline-7-carboxyl
2-{[2-(2,4-Dinitrophenyl)hydrazino]carbonyl}-8-hydroxyquinoline-7-carboxylic acid
AC1O585S
AIDS-209954
AIDS209954
CHEBI:232216
CHEMBL310321
CID6479612