Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Glutaminsaeure
PubChem ID:611
Pathway:-
InChI:InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/f/h7,9H
SMILES:C(CC(O)=O)C(C(O)=O)N

Properties:
Formula:C5H9NO4Atoms:10
Molecular Weight:147.129Rotatable Bonds:4
H-bond Acceptors:5H-bond Donors:0
logP:-0.0366
Targets:
Synonyms:
(+)-glutamic acid
(+-)-Glutamic acid
(2R)-2-aminopentanedioic acid
(R,S)-2-Amino-pentanedioicacid
(s)-()-glutamic acid
(S)-(+)-Glutamic acid
(S)-Glutamic acid
.alpha.-Aminoglutaric acid
.alpha.-Glutamic acid
1-Aminopropane-1,3-dicarboxylic acid
10549-13-0
138-15-8
138-16-9
16690-92-9
19238-49-4
19473-49-5
2-Aminoglutaric acid
2-Aminopentanedioic acid
2-Aminopentanedioic acid, (S)-
24595-14-0
4-04-00-03028 (Beilstein Handbook Reference)
55695-80-2
56-86-0
617-65-2
6893-26-1
6899-05-4
7558-63-6
96C32356-219C-4821-AF0E-30FCBFA1A321
AB1006897
AC1L19MA
AC1Q28OH
AC1Q28OI
AC1Q50AP
Acide glutamique [INN-French]
Acido glutamico [INN-Spanish]
Acidum glutamicum [INN-Latin]
Acidum glutaminicum
Aciglut
AG-G-25382
AI3-18472
AIDS-160294
AIDS160294
AKOS000118798
alpha-Aminoglutaric acid
alpha-Aminoglutaric acid (VAN)
AR-1J1186
AR-1J2903
bmse000037
BRN 1723799
C00302
C5H9NO4
CCRIS 7314
CHEBI:18237
D -2-Aminopentanedioic acid
D -alpha-Aminoglutaric acid
D-2-Aminopentanedioic acid
D-Glutamic acid
D-Glutamiensuur
D04341
DB02517
DL-Glutamate
DL-Glutamic acid
Dl-Glutamic Acid Hydrate
DL-Glutamic acid monohydrate
DL-Glutaminic acid
EINECS 200-293-7
EINECS 210-522-2
EPA Pesticide Chemical Code 374350
FEMA No. 3285
G0058
Glusate
Glutacid
Glutamate
Glutamate, L-
GLUTAMIC ACID
GLUTAMIC ACID (DL)
Glutamic acid (H-3)
Glutamic acid (USAN)
Glutamic acid (VAN)
Glutamic acid DL-form
Glutamic Acid [USAN:INN]
Glutamic acid, (S)-
Glutamic acid, D-
Glutamic acid, DL-
Glutamic acid, L-
Glutamicol
Glutamidex
Glutaminic acid
Glutaminic acid (VAN)
Glutaminol
Glutaminsaeure
Glutaton
H-DL-Glu-OH
I04-0186
I04-1092
I14-1312
L -2-Aminopentanedioic acid
l-()-glutamic acid
L-(+)-Glutamic acid
l-(5-14c)glutamic acid
L-2-Aminoglutaric acid
L-Glutamic acid
L-Glutaminic acid
L001165
LS-71759
MolPort-001-779-720
NCIOpen2_000764
NSC 143503
NSC 206301
NSC 9967
NSC143503
NSC206301
NSC620337
NSC77686
PDSP1_000621
PDSP2_000618
Pentanedioic acid, 2-amino-, (S)-
Poly-L-Glutamic Acid (MW50,600)
R-(-)-Glutamic acid
rac-(R*)-2-Aminopentanedioic acid;
STK017280
UNII-61LJO5I15S
WLN: QVYZ2VQ -L