Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Methylbenzenesulfonic acid
PubChem ID:6101
Pathway:-
InChI:InChI=1/C7H8O3S/c1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,1H3,(H,8,9,10)/f/h8H
SMILES:Cc1ccc(cc1)S(O)(=O)=O

Properties:
Formula:C7H8O3SAtoms:11
Molecular Weight:172.202Rotatable Bonds:1
H-bond Acceptors:3H-bond Donors:0
logP:2.3225
Targets:
Synonyms:
100901-72-2
104-15-4
114213-96-6
126033-27-0
128739-80-0
13438-45-4
13438-45-4 (zinc salt)
144647-92-7
1470-83-3
1470-83-3 (lithium salt)
156627-46-2
16106-44-8
16106-44-8 (potassium salt)
16836-95-6
16836-95-6 (silver(+1) salt)
185568-48-3
210357-81-6
227313-49-7
25231-46-3
36747-44-1
36747-44-1 (calcium salt)
369371-25-5
4-11-00-00241 (Beilstein Handbook Reference)
4-Methylbenzenesulfonic acid
4-TOLUENE-SULFONIC ACID
4-Toluenesulfonic acid
402-47-1
4124-42-9
4124-42-9 (ammonium salt)
51506-29-7
51650-46-5
51650-46-5 (magnesium salt)
613262-31-0
6192-52-5
6192-52-5 (monohydrate)
657-84-1
657-84-1 (hydrochloride salt)
7144-37-8
7144-37-8 (copper(2+) salt)
AB1002549
AC-794
AC1L1LT3
AC1Q2LRI
AC1Q2LRJ
AG-D-16010
AI3-26478
AIDS-018299
AIDS018299
ar-Toluenesulfonic acid
ar-Toluenesulfonic acid (8CI)
Benzenesulfonic acid, 4-methyl-
Benzenesulfonic acid, methyl-
BRN 0472690
C06677
CHEBI:27849
CHEBI:666779
CHEMBL541253
Cis-Tosylate
Cyclophil P T S A
Cyzac 4040
DB03120
EINECS 203-180-0
Eltesol
HSDB 2026
I01-0454
Jsp000415
Jsp003032
K-Cure 040
K-Cure 1040
Kyselina p-toluenesulfonova
Kyselina p-toluenesulfonova [Czech]
Kyselina p-toluensulfonova
Kyselina p-toluensulfonova [Czech]
LS-154156
Manro PTSA 65 E
Manro PTSA 65 H
Manro PTSA 65 LS
Methylbenzenesulfonic acid
MolPort-001-783-159
Nacure 1040
NCGC00248146-01
NCGC00248146-02
nchembio.157-comp12
NCIOpen2_002932
NCIOpen2_003096
NSC 167068
NSC167068
NSC2167
p-Methylbenzenesulfonic acid
p-Methylphenylsulfonic acid
p-Toluene sulfonate
p-Toluene-sulfonic acid
p-Toluenesulfonate
p-Toluenesulfonic acid
p-Toluenesulphonic acid
p-Toluolenesulfonic acid
p-Tolylsulfonic acid
PARA-TOLUENE SULFONATE
ST50825009
T0267
TL806147
Toluen-4-sulfonsaeure
Toluene sulfonic acid
Toluene-4-sulfonate
Toluene-4-sulfonic acid
Toluene-4-sulphonic acid
Toluene-p-sulfonate
Toluenesulfonic acid
Toluenesulfonic acid (VAN)
Toluenesulphonic acid
TOS
Tosic acid
Tosylate
tosylic acid
TSA-HP
TSA-MH
TSU
WLN: WSQR D1