Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Polysuccinimide
PubChem ID:5960
Pathway:Show KEGG pathways
InChI:InChI=1/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/f/h6,8H
SMILES:C([C@@H](C(O)=O)N)C(O)=O

Properties:
Formula:C4H7NO4Atoms:10
Molecular Weight:133.103Rotatable Bonds:3
H-bond Acceptors:5H-bond Donors:0
logP:-0.4267
Targets:
Synonyms:
()-aspartic acid
(+)-Aspartic acid
(2S)-2-aminobutanedioic acid
(2S)-Aspartic acid
(L)-ASPARTIC ACID
(S)-()-Aminosuccinic acid
(s)-()-aspartic acid
(S)-(+)-Aminosuccinic acid
(S)-(+)-Aspartic acid
(S)-2-aminobutanedioic acid
(S)-2-Aminosuccinic acid
(S)-Aminobutanedioic acid
(S)-Aminosuccinic Acid
(S)-Aspartic acid
1-amino-1,2-carboxyethane
1115-63-5
1115-63-5 (mono-potassium salt)
11189_FLUKA
11189_SIGMA
14007-45-5
14007-45-5 (potassium salt)
155436-59-2
155436-61-6
155436-63-8
155436-65-0
17090-93-6
17090-93-6 (hydrochloride salt)
181119-33-5
181119-34-6
2-Aminosuccinic acid
2001-89-0
2001-89-0 (di-potassium salt)
2068-80-6
2068-80-6 (magnesium (2:1) salt)
21059-46-1
21059-46-1 (calcium salt)
221628-95-1
25608-40-6
26834-87-7
27881-03-4
3792-50-5
3792-50-5 (mono-hydrochloride salt)
39162-75-9
39162-75-9 (calcium (2:1) salt)
4-04-00-02998 (Beilstein Handbook Reference)
5598-53-8
5598-53-8 (di-hydrochloride salt)
56-84-8
56-84-8 (Parent)
6899-03-2
90819-17-3
A 9256
A-9220
A0546
A4534_SIGMA
A4B5FB11-A4B6-4D75-9860-2ACF670700B9
A5474_SIGMA
A7219_SIGMA
A8949_SIGMA
A9256_SIGMA
AB1002629
AC1L1LI6
AC1Q4U77
Acide aspartique
Acide aspartique [INN-French]
Acido aspartico
Acido aspartico [INN-Spanish]
Acidum asparticum
Acidum asparticum [INN-Latin]
AI3-04461
AIDS-071820
AIDS071820
AmbotzHAA1073
Aminosuccinic acid
ASI
ASP
Asparagic acid
Asparagic acid (VAN)
Asparaginic acid
Asparaginic acid (VAN)
Asparaginsaeure
Asparaginsaeure [German]
Aspartate
Aspartate, L-
Aspartic acid
Aspartic acid (USP/INN)
Aspartic acid (VAN)
Aspartic Acid [USAN:INN]
Aspartic acid, L-
Aspartic acid, L- (8CI)
Aspatofort
Biomol-NT_000168
bmse000031
BPBio1_001128
BRN 1723530
Butanedioic acid, amino-, (S)-
C00049
Calcium dihydrogen di-L-aspartate
CCG-204228
CCRIs 6181
CHEBI:17053
CHEMBL274323
D00013
DB00128
DB02655
DL-Aspartic acid, homopolymer
EINECS 200-291-6
EINECS 254-327-0
EU-0100133
FEMA No. 3565
H-Asp-OH
HMS3260K08
HSDB 1430
I04-1073
I04-1122
I14-2732
L( )-Aminobernsteinsaeure
l-()-aspartic acid
L-(+)-Aspartic acid
L-2-Aminobutanedioic acid
L-Aminosuccinic acid
L-Asparagic acid
L-Asparaginic acid
L-Asparaginsaeure
L-Asparaginsyra
L-Aspartate
L-Aspartic acid
L-Aspartic acid (9CI)
L-Aspartic acid (JP15)
L-Aspartic acid (JP16)
L-Aspartic acid homopolymer
L-Aspartic acid, homopolymer
L-Aspartinsaeure
Lopac0_000133
LS-2569
NCGC00024499-01
NCGC00024499-02
NCGC00024499-03
NCGC00024499-04
NCGC00024499-05
nchem.1108-comp3d
nchembio.186-comp25
NChemBio.2007.11-comp17
nchembio816-comp6
NSC 3973
NSC3973
PDSP1_000819
PDSP2_000806
Poly-DL-succinimide
Polysuccinimide
TL806193
Tocris-0214
UNII-30KYC7MIAI