Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:PRALIDOXIME CHLORIDE
PubChem ID:5359226
Pathway:-
InChI:InChI=1S/C7H8N2O.ClH/c1-9-5-3-2-4-7(9)6-8-10;/h2-6H,1H3;1H/b7-6+;
SMILES:O=[N+]/C=c/1\ccccn1C.[Cl-]

Properties:
Formula:C7H9ClN2OAtoms:11
Molecular Weight:172.612Rotatable Bonds:1
H-bond Acceptors:2H-bond Donors:1
logP:-2.8496
Targets:
Synonyms:
()-oxazepam hemisuccinate sodium salt
1-Methyl-2-aldoximinopyridinium chloride
1-Methyl-2-formylpyridinium chloride oxime
1-Methyl-2-pyridinium aldoxime chloride
1-Methylpyridinium-2-aldoxime Chloride
2-(Hydroxyiminomethyl)-1-methylpyridinium chloride
2-Formyl-1-methylpyridinium chloride oxime
2-Formyl-N-methylpyridinium oxime chloride
2-Hydroxyiminomethyl-1-methylpyridinium chloride
2-PAM chloride
2-Pyridine aldoxime methyl chloride
2-Pyridine-aldoxime chloride
2-Pyridinealdoxime methochloride
2-[(1E)-(hydroxyimino)methyl]-1-methylpyridin-1-ium chloride
2-[(E)-(hydroxyimino)methyl]-1-methylpyridinium chloride
51-15-0
6735-59-7
AC1NSDWQ
AC1Q1RUT
AKOS001094374
ATNAA
C7H9N2O.HCl
CHEBI:8355
CHEMBL748
ComboPen
D00469
EINECS 200-080-9
HMS1570N08
HMS2097N08
HMS3259I04
LS-132536
M0819
MLS000028727
MLS001076535
MLS002222315
MolPort-004-440-359
N-Methylpyridine-2-aldoxime chloride
N-Methylpyridinium chloride 2-aldoxime
N-Methylpyridinium-2-aldoxime chloride
N-Metylpyridinium-2-aldoxime chloride
NSC 164614
NSC164614
Pam 2Cl
Pralidoxime
Pralidoxime (INN)
PRALIDOXIME CHLORIDE
Pralidoxime chloride (USP)
Pralidoxime chloride [USAN]
Pralidoxine chloride
Protopam
Protopam (TN)
Protopam chloride
Pyridine-2-aldoxime methochloride
Pyridinium aldoxime methochloride
Pyridinium, 2-((hydroxyimino)methyl)-1-methyl-, chloride
Pyridinium, 2-formyl-1-methyl-, chloride, oxime
Pyridinium, 2-[(hydroxyimino)methyl]-1-methyl-, chloride
SMR000059189
ST50825032
T0510-8490
UNII-38X7XS076H
WLN: T6KJ A1 B1UNQ &G
[(E)-(1-methylpyridin-2-ylidene)methyl]-oxoazanium chloride