Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Dihomolinolenic acid
PubChem ID:5312529
Pathway:-
InChI:InChI=1/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10H,2,5,8,11-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-/f/h21H
SMILES:CCC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CCCCCCCCCC(O)=O

Properties:
Formula:C20H34O2Atoms:28
Molecular Weight:306.483Rotatable Bonds:15
H-bond Acceptors:2H-bond Donors:0
logP:6.4407
Targets:
NameUniprot IDSourceReferencesInteraction
Tissue factorTF_HUMANBindingDB-shows
TrypsinTRYP_PIGBindingDB-shows
Synonyms:
(11Z,14Z,17Z)-Eicosa-11,14,17-trienoic acid
(11Z,14Z,17Z)-Icosa-11,14,17-trienoic acid
(all-cis)-11,14,17-Eicosatrienoic acid
(all-cis)-Delta11,14,17-Eicosatrienoic acid
(Z,Z,Z)-11,14,17-Eicosatrienoic acid
11,14,17-Eicosatrienoic acid
11,14,17-eicosatrienoic acid, (11Z,14Z,17Z)-
11,14,17-Eicosatrienoic acid, (11Z,14Z,17Z)- (9CI)
11,14,17-Eicosatrienoic acid, (Z,Z,Z)-
11,14,17-Eicosatrienoic acid, (Z,Z,Z)- (8CI)
11,14,17-Icosatrienoic acid
11-cis,14-cis,17-cis-Eicosatrienoic acid
11c,14c,17c-eicosatrienoic acid
11c,14c,17c-Eicosatriensaeure
11Z,14Z,17Z-Eicosatrienoic acid
17046-59-2
20:3, n-3,6,9 all-cis
AC1NSMYJ
all-cis-11,14,17-eicosatrienoic acid
all-cis-Eicosa-11,14,17-triensaeure
BCBcMAP01_000183
Bishomo-alpha-linolenic acid
BML3-B10
BRD-K63913457-001-02-7
BSPBio_001330
C16522
C20:3, n-3,6,9 all-cis
C20:3n-3,6,9
CHEBI:53460
CHEMBL453991
cis,cis,cis-11,14,17-Eicosatrienoic acid
Dihomolinolenic acid
eicosa-11Z,14Z,17Z-trienoic acid
Eicosatrienoic acid
EICOSATRIENOIC ACID (20:3 n-3)
ETA
HMS1361C12
HMS1791C12
HMS1989C12
Homo-alpha-linolenic acid
Icosatrienoic acid
IDI1_033800
LMFA01030378
NCGC00161349-01
NCGC00161349-02
NCGC00161349-03