Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Ginkgolic acid
PubChem ID:5281858
Pathway:-
InChI:InChI=1/C22H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h7-8,15,17-18,23H,2-6,9-14,16H2,1H3,(H,24,25)/b8-7-/f/h24H
SMILES:CCCCCCC(/[H])=C(/[H])CCCCCCCc1cccc(c1C(O)=O)O

Properties:
Formula:C22H34O3Atoms:27
Molecular Weight:346.504Rotatable Bonds:14
H-bond Acceptors:3H-bond Donors:0
logP:6.5001
Targets:
NameUniprot IDSourceReferencesInteraction
Tissue factorTF_HUMANBindingDB-shows
TrypsinTRYP_PIGBindingDB-shows
Synonyms:
2-hydroxy-6-[(Z)-pentadec-8-enyl]benzoic acid
22910-60-7
AC-12804
AC1NQZ6U
Ambotz22910-60-7
Anacardic acid B
BSPBio_002625
C10794
CCG-38715
CHEBI:545071
CHEMBL445177
Ginkgoic acid
Ginkgolic acid
MolPort-003-665-927
NCGC00095338-01
NCGC00095338-02
SDCCGMLS-0066799.P001
SPECTRUM1505247
Spectrum5_000899