Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Myristoleic acid
PubChem ID:5281119
Pathway:Show KEGG pathways
InChI:InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/b6-5-
SMILES:CCCC/C=C\CCCCCCCC(=O)O

Properties:
Formula:C14H26O2Atoms:16
Molecular Weight:226.355Rotatable Bonds:11
H-bond Acceptors:2H-bond Donors:1
logP:4.5481
Targets:
NameUniprot IDSourceReferencesInteraction
Tissue factorTF_HUMANBindingDB-shows
TrypsinTRYP_PIGBindingDB-shows
Synonyms:
()-oxazepam hemisuccinate sodium salt
(9Z)-tetradec-9-enoic acid
(9Z)-Tetradecenoic acid
(Z)-Tetradec-9-enoic acid
544-64-9
9-Tetradecenoic acid
9-Tetradecenoic acid, (9Z)-
9-Tetradecenoic acid, (Z)-
9Z-tetradecenoic acid
AC1NQY1Z
AIDS-212981
AIDS212981
C08322
C14:1n-5
CHEBI:27781
CHEMBL456732
cis-9-tetradecenoic acid
cis-Delta(9)-tetradecenoic acid
cis-tetradec-9-enoic acid
EINECS 208-876-8
LMFA01030051
M3525_SIGMA
Myristoleic acid