Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Linolenate
PubChem ID:5280934
Pathway:Show KEGG pathways
InChI:InChI=1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-/f/h19H
SMILES:CCC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CCCCCCCC(O)=O

Properties:
Formula:C18H30O2Atoms:26
Molecular Weight:278.43Rotatable Bonds:13
H-bond Acceptors:2H-bond Donors:0
logP:5.6605
Targets:
Synonyms:
(9,12,15)-linolenic acid
(9Z,12Z,15Z)-9,12,15-Octadecatrienoic acid
(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid
(9Z,12Z,15Z)-Octadecatrienoic acid
(9Z,12Z,15Z)octadeca-9,12,15-trienoic acid
(all-Z)-9,12,15-Octadecatrienoic acid
(Z,Z,Z)-9,12,15-Octadecatrienoic acid
(Z,Z,Z)-Octadeca-9,12,15-trienoic acid
2DCD0473-E5CC-47BB-A0A4-95899AFF6C4B
463-40-1
62160_FLUKA
62170_FLUKA
62170_SIGMA
9,12,15-all-cis-Octadecatrienoic acid
9,12,15-Octadecatrienoic acid
9,12,15-octadecatrienoic acid, (9Z,12Z,15Z)-
9,12,15-Octadecatrienoic acid, (9Z,12Z,15Z)- (9CI)
9,12,15-Octadecatrienoic acid, (Z,Z,Z)-
9-cis,12-cis,15-cis-Octadecatrienoic acid
9Z,12Z,15Z-Octadecatrienoic acid
AC1NQXSA
AI3-23986
ALA
all-cis-9,12,15-Octadecatrienoic acid
alpha-Linolenate
alpha-Linolenic acid
alpha-Lnn
BML3-B05
BRD-K33396764-001-02-0
BSPBio_001376
C06427
C18:3n-3,6,9
CCRIS 656
CHEBI:27432
CHEMBL8739
cis,cis,cis-9,12,15-Octadecatrienoic acid
cis-9, cis-12, cis-15-octadecatrienoic acid
cis-9,cis-12,cis-15-Octadecatrienoic acid
cis-Delta(9,12,15)-octadecatrienoic acid
cis-Delta9,12,15-Octadecatrienoic acid
CMC_7371
DB00132
HMS1361E18
HMS1791E18
HMS1989E18
HMS2233C13
IDI1_033846
L000707
L0050
L2376_SIGMA
Linolenate
Linolenic acid
LINOLENIC ACID (18:3 n-3)
Linolenic acid (8CI)
LMFA01030152
LNL
MLS001336029
MLS001336030
MLS002454413
NCGC00091058-01
NCGC00091058-02
NCGC00091058-04
NCGC00091058-05
NCGC00091058-06
NCGC00091058-07
NCGC00091058-08
NCGC00091058-09
NCGC00091058-10
nchembio.161-comp1
Octadecatrienoic acid, 9,12,15-(Z,Z,Z)-
SMR000857336
ST072192