Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Viacutan
PubChem ID:5280933
Pathway:-
InChI:InChI=1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10,12-13H,2-5,8,11,14-17H2,1H3,(H,19,20)/b7-6-,10-9-,13-12-/f/h19H
SMILES:CCCCCC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CCCCC(O)=O

Properties:
Formula:C18H30O2Atoms:26
Molecular Weight:278.43Rotatable Bonds:13
H-bond Acceptors:2H-bond Donors:0
logP:5.6605
Targets:
NameUniprot IDSourceReferencesInteraction
Tissue factorTF_HUMANBindingDB-shows
TrypsinTRYP_PIGBindingDB-shows
Synonyms:
(6,9,12)-linolenic acid
(6Z,9Z,12Z)-octadeca-6,9,12-trienoic acid
(6Z,9Z,12Z)-Octadecatrienoic acid
(Z,Z,Z)-6,9,12-Octadecatrienoic acid
18:3 (n-6)
506-26-3
6(Z),9(Z),12(Z)-Octadecatrienoic acid
6,9,12-all-cis-Octadecatrienoic acid
6,9,12-Octadecatrienoic acid
6,9,12-Octadecatrienoic acid, (6Z,9Z,12Z)-
6,9,12-Octadecatrienoic acid, (Z,Z,Z)-
6-cis,9-cis,12-cis-Octadecatrienoic acid
62174_FLUKA
AC1NQXS7
Acide gamolenique
Acide gamolenique [French]
Acido gamolenico
Acido gamolenico [Spanish]
Acidum gamolenicum
Acidum gamolenicum [Latin]
AIDS-032935
AIDS032935
all-cis-6,9,12-Octadecatrienoic acid
Ambap506-26-3
Ambap6012
BML3-B06
BRD-K18059238-001-02-1
BSPBio_001338
C06426
C18:3 (n-6)
C18:3, n-6,9,12 all-cis
C18:3n-6,9,12
CCRIS 7668
CHEBI:28661
CHEMBL464982
cis,cis,cis,6,9,12-Octa-decatrienoic acid-18:3 n6 lithium salt
cis,cis,cis-6,9,12-Octadecatrienoic acid
cis-6, cis-9, cis-12-octadecatrienoic acid
cis-6,cis-9,cis-12-Octadecatrienoic acid
cis-Delta(6,9,12)-octadecatrienoic acid
D07213
D58CCA4A-7FFA-4E8B-A758-EAA7D073B343
Efamast
Epogam
gamma-Linolenic acid
GAMMA-LINOLENIC ACID (18:3 n-6)
gamma-Linolensaeure
gamoleic acid
Gamolenic acid
Gamolenic acid (INN)
Gamolenic acid [BAN:INN]
Gamolenic acid [INN:BAN]
GLA
HMS1361C20
HMS1791C20
HMS1989C20
HMS2230A18
IDI1_033808
L0152
L2378_SIGMA
Ligla
LMFA01030141
LS-97722
MLS001333661
MLS001333662
NCGC00160469-01
NCGC00160469-02
NCGC00160469-03
NCGC00160469-04
Octadeca-6,9,12-triensaeure
Octadecatrienoic acid, 6,9,12-(Z,Z,Z)-
SMR000058609
Viacutan
ATC-Codes: