Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Macrophyllin B
PubChem ID:45487148
Pathway:-
InChI:InChI=1S/C22H28O6/c1-7-8-13-11-22(28-6)12(2)17(18(19(13)23)21(22)24)14-9-15(25-3)20(27-5)16(10-14)26-4/h7,9-12,17-19,23H,1,8H2,2-6H3/t12-,17+,18?,19-,22-/m1/s1
SMILES:C=CCC1=C[C@]2(OC)C(=O)C([C@@H]1O)[C@@H]([C@H]2C)c1cc(OC)c(c(c1)OC)OC

Properties:
Formula:C22H28O6Atoms:28
Molecular Weight:388.454Rotatable Bonds:7
H-bond Acceptors:6H-bond Donors:1
logP:2.8932
Targets:
Synonyms:
CHEBI:681434
CHEMBL585912
Macrophyllin B