Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:4'-oxo-macrophyllin B
PubChem ID:45487143
Pathway:-
InChI:InChI=1S/C22H26O6/c1-7-8-13-11-22(28-6)12(2)17(18(19(13)23)21(22)24)14-9-15(25-3)20(27-5)16(10-14)26-4/h7,9-12,17-18H,1,8H2,2-6H3/t12-,17+,18?,22-/m1/s1
SMILES:C=CCC1=C[C@@]2(OC)[C@@H]([C@H](C(C1=O)C2=O)c1cc(OC)c(c(c1)OC)OC)C

Properties:
Formula:C22H26O6Atoms:28
Molecular Weight:386.438Rotatable Bonds:7
H-bond Acceptors:6H-bond Donors:0
logP:3.1014
Targets:
Synonyms:
4'-oxo-macrophyllin B
CHEBI:681424
CHEMBL584539