Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Cinerin B
PubChem ID:45487095
Pathway:-
InChI:InChI=1S/C21H24O6/c1-5-6-12-9-21(25-4)11(2)16(17(18(12)22)20(21)23)13-7-14(24-3)19-15(8-13)26-10-27-19/h5,7-9,11,16-17,20,23H,1,6,10H2,2-4H3/t11-,16+,17?,20+,21-/m1/s1
SMILES:C=CCC1=C[C@@]2(OC)[C@@H]([C@H]([C@H](C1=O)[C@@H]2O)c1cc(OC)c2c(c1)OCO2)C

Properties:
Formula:C21H24O6Atoms:27
Molecular Weight:372.412Rotatable Bonds:5
H-bond Acceptors:6H-bond Donors:1
logP:2.6047
Targets:
Synonyms:
CHEBI:681315
CHEMBL570981
Cinerin B