Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Eicosapentaenoic acid
PubChem ID:446284
Pathway:Show KEGG pathways
InChI:InChI=1/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,13-12-,16-15-/f/h21H
SMILES:CCC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CCCC(O)=O

Properties:
Formula:C20H30O2Atoms:32
Molecular Weight:302.451Rotatable Bonds:13
H-bond Acceptors:2H-bond Donors:0
logP:5.9927
Targets:
Synonyms:
(5Z,8Z,11Z,14Z,17Z)-5,8,11,14,17-eicosapentaenoic acid
(5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoate
(5Z,8Z,11Z,14Z,17Z)-Eicosapentaenoic acid
(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoic acid
(5Z,8Z,11Z,14Z,17Z)-Icosapentaenoic acid
(all-cis)-5,8,11,14,17-Eicosapentaenoic acid
(all-Z)-5,8,11,14,17-Eicosapentaenoic acid
(all-Z)-delta5,8,11,14,17-Eicosapentaenoic acid
(Z,Z,Z,Z,Z)-5,8,11,14,17-eicosapentaenoic acid
10417-94-4
1553-41-9
1553-41-9 (CIS/TRANS UNDEFINED)
25377-48-4
3gwx
44864_FLUKA
5,8,11,14,17-Eicosapentaenoic acid
5,8,11,14,17-Eicosapentaenoic acid (6CI)
5,8,11,14,17-EICOSAPENTAENOIC ACID (All CIS)
5,8,11,14,17-Eicosapentaenoic acid, (5Z,8Z,11Z,14Z,17Z)-
5,8,11,14,17-Eicosapentaenoic acid, (5Z,8Z,11Z,14Z,17Z)- (9CI)
5,8,11,14,17-Eicosapentaenoic acid, (all-Z)-
5,8,11,14,17-Eicosapentaenoic acid, (all-Z)- (8CI)
5,8,11,14,17-Icosapentaenoic acid
5Z,8Z,11Z,14Z,17Z-Eicosapentaenoic acid
7F8BF016-B146-4F72-A52E-B9298BA3A9AB
AC1L9JFR
AIDS-082784
AIDS082784
all cis-5,8,11,14,17-Eicosapentaenoic Acid
all cis-5,8,11,14,17-Icosapentaenoic Acid
all-cis-icosa-5,8,11,14,17-pentaenoic acid
BML3-B01
BRD-K47192521-001-02-1
BSPBio_001328
C06428
C20:5 omega-3
CCRIS 3279
CHEBI:28364
CHEMBL460026
cis, cis, cis, cis, cis-eicosa-5,8,11,14,17-pentaenoic acid
cis-5,8,11,14,17-Eicosapentaenoic acid
cis-5,8,11,14,17-EPA
cis-Delta(5,8,11,14,17)-eicosapentaenoic acid
D08061
DB00159
E0441
E2011_SIGMA
E7006_SIGMA
Eicosapentaenoic acid
EICOSAPENTAENOIC ACID (20:5 n-3)
Eicosapentaenoic acid, 5,8,11,14,17-(Z,Z,Z,Z,Z)-
EPA
HMS1361C10
HMS1791C10
HMS1989C10
Icosapent
Icosapent [INN]
Icosapentaenoic acid
Icosapento
Icosapento [INN-Spanish]
Icosapentum
Icosapentum [INN-Latin]
IDI1_033798
L001256
LMFA01030759
NCGC00161344-01
NCGC00161344-02
NCGC00161344-03
NCGC00161344-04
Timnodonic acid
Timnodonic acid;