Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:palmitolinoleic acid
PubChem ID:445638
Pathway:Show KEGG pathways
InChI:InChI=1/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7-/f/h17H
SMILES:CCCCCCC(/[H])=C(/[H])CCCCCCCC(O)=O

Properties:
Formula:C16H30O2Atoms:20
Molecular Weight:254.408Rotatable Bonds:13
H-bond Acceptors:2H-bond Donors:0
logP:5.3283
Targets:
Synonyms:
(9Z)-hexadec-9-enoic acid
(9Z)-Hexadecenoic acid
(Z)-9-hexadecenoic acid
(Z)-hexadec-9-enoic acid
(Z)-Palmitoleic acid
16:1Delta9
373-49-9
76169_FLUKA
9-cis-Hexadecenoic acid
AC1L9IBI
C08362
C16:1n-7
CHEBI:28716
CHEMBL453509
cis-9-Hexadecenoic acid
cis-9-hexadecenoic acid;9Z-palmitoleic acid
cis-Delta(9)-hexadecenoic acid
ED9A824A-5CB7-476E-884E-4216DD38386E
H0072
LMFA01030056
NCGC00248225-01
nchembio.103-comp15
NSC277452
P9417_SIGMA
Palmitoleic acid
palmitolinoleic acid
PAM
zoomaric acid