Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Doconexent
PubChem ID:445580
Pathway:-
InChI:InChI=1/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-/f/h23H
SMILES:CCC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CCC(O)=O

Properties:
Formula:C22H32O2Atoms:36
Molecular Weight:328.488Rotatable Bonds:14
H-bond Acceptors:2H-bond Donors:0
logP:6.5489
Targets:
Synonyms:
"cervonic acid; docosahexaenoic acid"
(4Z,7Z,10Z,13Z,16Z,19Z)-4,7,10,13,16,19-Docosahexaenoic acid
(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoic acid
(4Z,7Z,10Z,13Z,16Z,19Z)-Docosahexaenoic acid
(all-Z)-4,7,10,13,16,19-Docosahexaenoic acid
1fdq
22:6(n-3)
25377-50-8
4,7,10,13,16,19-Docosahexaenoic acid
4,7,10,13,16,19-Docosahexaenoic acid, (4Z,7Z,10Z,13Z,16Z,19Z)-
4,7,10,13,16,19-Docosahexaenoic acid, (4Z,7Z,10Z,13Z,16Z,19Z)- (9CI)
4,7,10,13,16,19-Docosahexaenoic acid, (all-Z)-
4,7,10,13,16,19-Docosahexaenoic acid, (all-Z)- (8CI)
4-cis,7-cis,10-cis,13-cis,16-cis,19-cis-Docosahexaenoic acid
6217-54-5
800E8E72-BBF4-46F7-A60B-B8F2B54669C7
AC-1010
AC1L9I8O
all-cis-4,7,10,13,16,19-Docosahexaenoic acid
all-cis-DHA
all-cis-docosa-4,7,10,13,16,19-hexaenoic acid
all-Z-Docosahexaenoic acid
BCBcMAP01_000145
BML3-B02
BRD-K39965020-001-02-6
BSPBio_001298
C06429
C22:6n-3,6,9,12,15,18
CCRIS 7670
Cervonic acid
Cervonic acid; Docosahexaenoic acid
CHEBI:28125
CHEMBL367149
cis-4,7,10,13,16,19-Docosahexaenoic acid
D2226
D2534_SIGMA
delta4,7,10,13,16,19-Docosahexaenoic acid
DHA
Doconexent
Doconexent [INN]
Doconexento
Doconexento [INN-Spanish]
Doconexentum
Doconexentum [INN-Latin]
DOCOSA-4,7,10,13,16,19-HEXAENOIC ACID
Docosahexaenoic acid
DOCOSAHEXAENOIC ACID (22:6 n-3)
Docosahexaenoic acid (6CI)
Docosahexaenoic acid (all-Z)
Doxonexent
FT-0082651
HMS1361A20
HMS1791A20
HMS1989A20
HXA
IDI1_033768
LMFA01030185
NCGC00161345-01
NCGC00161345-02
NCGC00161345-03
NCGC00161345-04
NCGC00161345-05
nchembio.367-comp1
Spectrum5_002062
UNII-ZAD9OKH9JC