Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Arachidonsaeure
PubChem ID:444899
Pathway:Show KEGG pathways
InChI:InChI=1/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,13-12-,16-15-/f/h21H
SMILES:CCCCCC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CC(/[H])=C(/[H])CCCC(O)=O

Properties:
Formula:C20H32O2Atoms:30
Molecular Weight:304.467Rotatable Bonds:14
H-bond Acceptors:2H-bond Donors:0
logP:6.2167
Targets:
Synonyms:
(14C)Arachidonic acid
(5Z,8Z,11Z,14Z)-5,8,11,14-icosatetraenoic acid
(5Z,8Z,11Z,14Z)-Eicosatetraenoic acid
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid
(5Z,8Z,11Z,14Z)-Icosatetraenoic acid
(5Z,8Z,11Z,14Z)icosa-5,8,11,14-tetraenoic acid
10931_FLUKA
10931_SIGMA
1adl
1gnj
1vyg
5,8,11,14-Eicosatetraenoic acid
5,8,11,14-Eicosatetraenoic acid, (all-Z)-
5,8,11,14-Eicosatetraenoic acid, labeled with carbon-14, (all-Z)-
5,8,11,14-Icosatetraenoic Acid
506-32-1
5Z,8Z,11Z,14Z-icosatetraenoic acid
93444-49-6
A0781
A3555_SIGMA
A3925_SIGMA
A9673_SIGMA
AA
AB1004494
AC-14348
AC1L9H30
ACD
AG-F-70356
AIDS-045704
AIDS045704
all-cis-5,8,11,14-eicosatetraenoic acid
ARA
Arachidonate
Arachidonic acid
ARACHIDONIC ACID (20:4 n-6)
Arachidonsaeure
BML3-B03
BRD-K03070961-001-02-8
BSPBio_001539
C00219
CHEBI:15843
CHEMBL15594
cis,cis,cis,cis-5,8,11,14-Eicosatetraenoic acid
cis,cis,cis,cis-5,8,11,14-Eicosatetraenoic acid;
cis-5,8,11,14-Eicosatetraenoic acid
cis-Delta(5,8,11,14)-eicosatetraenoic acid
D18DBC10-379C-4E78-9A50-8B791A2F4E68
Eicosa-5Z,8Z,11Z,14Z-tetraenoic acid
HMS1361M21
HMS1791M21
HMS1989M21
Icosa-5,8,11,14-tetraenoic acid
IDI1_034009
LMFA01030001
MLS001361328
MolPort-003-666-529
NCGC00094608-01
NCGC00094608-02
NCGC00094608-03
NCGC00094608-04
NCGC00094608-05
NCGC00094608-06
nchembio.129-comp13
nchembio.86-comp6
SMR000857374
Spectrum5_001910
ST069383
[1-14C]Arachidonic acid