Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Ocophyllals B
PubChem ID:44470606
Pathway:-
InChI:InChI=1S/C20H20O6/c1-11-14-6-12(10-21)7-15(22-2)19(14)26-18(11)13-8-16(23-3)20(25-5)17(9-13)24-4/h6-10H,1-5H3
SMILES:O=Cc1cc(OC)c2c(c1)c(C)c(o2)c1cc(OC)c(c(c1)OC)OC

Properties:
Formula:C20H20O6Atoms:26
Molecular Weight:356.369Rotatable Bonds:6
H-bond Acceptors:6H-bond Donors:0
logP:4.2551
Targets:
Synonyms:
CHEBI:681426
CHEMBL571617
Ocophyllals B