Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:(+)-Denudatin B
PubChem ID:40617444
Pathway:-
InChI:InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20-,21-/m1/s1
SMILES:C=CCC1=C[C@]2(OC)C(=CC1=O)O[C@H]([C@H]2C)c1ccc(c(c1)OC)OC

Properties:
Formula:C21H24O5Atoms:26
Molecular Weight:356.412Rotatable Bonds:6
H-bond Acceptors:5H-bond Donors:0
logP:3.7655
Targets:
Synonyms:
()-oxazepam hemisuccinate sodium salt
(+)-Denudatin B
CHEBI:681437
CHEMBL571196
ZINC06468453