Drug Details |  |
| Name: | IOVERSOL |  |
|---|
| PubChem ID: | 3741 |
|---|
| Pathway: | Show KEGG pathways |
|---|
| InChI: | InChI=1/C18H24I3N3O9/c19-13-11(17(32)22-3-8(29)5-26)14(20)16(24(1-2-25)10(31)7-28)15(21)12(13)18(33)23-4-9(30)6-27/h8-9,25-30H,1-7H2,(H,22,32)(H,23,33)/f/h22-23H
|
|---|
| SMILES: | C(CO)N(C(CO)=O)c1c(c(c(c(c1I)C(NCC(CO)O)=O)I)C(NCC(CO)O)=O)I |
|---|
|
| Properties: | | Formula: | C18H24I3N3O9 | Atoms: | 33 |
|---|
| Molecular Weight: | 807.111 | Rotatable Bonds: | 15 |
|---|
| H-bond Acceptors: | 11 | H-bond Donors: | 0 |
|---|
| logP: | -1.2342 | | |
|---|
|
|---|
| Targets: | |
|---|
| Synonyms: | | 1,3-Benzenedicarboxamide, N,N'-bis(2,3-dihydroxypropyl)-5-((hydroxyacetyl)(2-hydroxyethyl)amino)-2,4,6-triiodo- | | 87771-40-2 | | AB00513943 | | BPBio1_001051 | | BRN 7155654 | | BSPBio_000955 | | D01555 | | IOVERSOL | | Ioversol (JAN/USP/INN) | | Ioversol [USAN:BAN:INN] | | Ioversol [USAN:INN:BAN] | | Ioversolum [Latin] | | LS-29726 | | MP-328 | | N,N -bis(2,3-dihydroxypropyl)-5-[N-(2-hydroxyethyl)-glycolamidol]-2,4,6-triiodoisophthalamide | | N,N'-Bis(2,3-dihydroxypropyl)-5-(N-(2-hydroxyethyl)glycolamido)-2,4,6-triiodoisophthalamide | | n,n'-bis(2,3-dihydroxypropyl)-5-[glycoloyl(2-hydroxyethyl)amino]-2,4,6-tri | | NCGC00179364-01 | | Optiray | | Optiray (TN) | | Optiray 160 | | Optiray 240 | | Optiray 320 | | Optiray 350 | | Prestwick0_000878 | | Prestwick1_000878 | | Prestwick2_000878 | | Prestwick3_000878 | | SPBio_002876 |
|
|---|
| ATC-Codes: | |
|---|
| Side-Effects: | | Side-Effect | Frequency |
|---|
| paresthesia | 0 | | tachycardia | 0 | | thrombophlebitis | 0 | | tinnitus | 0 | | tremor | 0 | | loss of consciousness | 0 | | erythema | 0 | | urticaria | 0 | | vasovagal reaction | 0 | | venous thrombosis | 0 | | syncope | 0 | | spasm | 0 | | sneezing | 0 | | polyuria | 0 | | puncture | 0 | | proteinuria | 0 | | pruritus | 0 | | pulmonary edema | 0 | | purpura | 0 | | renal failure | 0 | | seizures | 0 | | shock | 0 | | ventricular fibrillation | 0 | | vertigo | 0 | | lightheadedness | 0 | | visual hallucinations | 0 | | hypoxia | 0 | | blurred vision | 0 | | shortness of breath | 0 | | bradycardia | 0 | | blindness | 0 | | paralysis | 0 | | dysphasia | 0 | | sinus arrest | 0 | | respiratory arrest | 0 | | renal colic | 0 | | vomiting | 0 | | wheezing | 0 | | dry mouth | 0 | | urinary retention | 0 | | chills | 0 | | agitation | 0 | | peripheral edema | 0 | | neck rigidity | 0 | | myocardial ischemia | 0 | | allergic reaction | 0 | | pain | 0 | | anaphylaxis | 0 | | choking | 0 | | coma | 0 | | confusion | 0 | | conjunctivitis | 0 | | convulsions | 0 | | cough | 0 | | diarrhea | 0 | | somnolence | 0 | | dyspnea | 0 | | chest pain | 0 | | cerebral infarction | 0 | | bundle branch block | 0 | | aneurysm | 0 | | angina pectoris | 0 | | angioedema | 0 | | anxiety | 0 | | aphasia | 0 | | apnea | 0 | | arrhythmia | 0 | | asthma | 0 | | bronchospasm | 0 | | ecchymosis | 0 | | edema | 0 | | hemorrhage | 0 | | hypersensitivity | 0 | | hypertension | 0 | | hypotension | 0 | | nephropathy | 0 | | myocardial infarction | 0 | | nasal congestion | 0 | | nausea | 0 | | neutropenia | 0 | | hemiplegia | 0 | | hemiparesis | 0 | | hematuria | 0 | | rash | 0 | | fever | 0 | | flushing | 0 | | hallucinations | 0 | | headache | 0 | | cardiac arrest | 0 | | heart block | 0 | | congestive heart failure | 0 | | hematoma | 0 | | nystagmus | 0 |
|
|---|
