Drug Details |  |
Name: | IOVERSOL |  |
---|
PubChem ID: | 3741 |
---|
Pathway: | Show KEGG pathways |
---|
InChI: | InChI=1/C18H24I3N3O9/c19-13-11(17(32)22-3-8(29)5-26)14(20)16(24(1-2-25)10(31)7-28)15(21)12(13)18(33)23-4-9(30)6-27/h8-9,25-30H,1-7H2,(H,22,32)(H,23,33)/f/h22-23H
|
---|
SMILES: | C(CO)N(C(CO)=O)c1c(c(c(c(c1I)C(NCC(CO)O)=O)I)C(NCC(CO)O)=O)I |
---|
|
Properties: | Formula: | C18H24I3N3O9 | Atoms: | 33 |
---|
Molecular Weight: | 807.111 | Rotatable Bonds: | 15 |
---|
H-bond Acceptors: | 11 | H-bond Donors: | 0 |
---|
logP: | -1.2342 | | |
---|
|
---|
Targets: | |
---|
Synonyms: | 1,3-Benzenedicarboxamide, N,N'-bis(2,3-dihydroxypropyl)-5-((hydroxyacetyl)(2-hydroxyethyl)amino)-2,4,6-triiodo- | 87771-40-2 | AB00513943 | BPBio1_001051 | BRN 7155654 | BSPBio_000955 | D01555 | IOVERSOL | Ioversol (JAN/USP/INN) | Ioversol [USAN:BAN:INN] | Ioversol [USAN:INN:BAN] | Ioversolum [Latin] | LS-29726 | MP-328 | N,N -bis(2,3-dihydroxypropyl)-5-[N-(2-hydroxyethyl)-glycolamidol]-2,4,6-triiodoisophthalamide | N,N'-Bis(2,3-dihydroxypropyl)-5-(N-(2-hydroxyethyl)glycolamido)-2,4,6-triiodoisophthalamide | n,n'-bis(2,3-dihydroxypropyl)-5-[glycoloyl(2-hydroxyethyl)amino]-2,4,6-tri | NCGC00179364-01 | Optiray | Optiray (TN) | Optiray 160 | Optiray 240 | Optiray 320 | Optiray 350 | Prestwick0_000878 | Prestwick1_000878 | Prestwick2_000878 | Prestwick3_000878 | SPBio_002876 |
|
---|
ATC-Codes: | |
---|
Side-Effects: | Side-Effect | Frequency |
---|
paresthesia | 0 | tachycardia | 0 | thrombophlebitis | 0 | tinnitus | 0 | tremor | 0 | loss of consciousness | 0 | erythema | 0 | urticaria | 0 | vasovagal reaction | 0 | venous thrombosis | 0 | syncope | 0 | spasm | 0 | sneezing | 0 | polyuria | 0 | puncture | 0 | proteinuria | 0 | pruritus | 0 | pulmonary edema | 0 | purpura | 0 | renal failure | 0 | seizures | 0 | shock | 0 | ventricular fibrillation | 0 | vertigo | 0 | lightheadedness | 0 | visual hallucinations | 0 | hypoxia | 0 | blurred vision | 0 | shortness of breath | 0 | bradycardia | 0 | blindness | 0 | paralysis | 0 | dysphasia | 0 | sinus arrest | 0 | respiratory arrest | 0 | renal colic | 0 | vomiting | 0 | wheezing | 0 | dry mouth | 0 | urinary retention | 0 | chills | 0 | agitation | 0 | peripheral edema | 0 | neck rigidity | 0 | myocardial ischemia | 0 | allergic reaction | 0 | pain | 0 | anaphylaxis | 0 | choking | 0 | coma | 0 | confusion | 0 | conjunctivitis | 0 | convulsions | 0 | cough | 0 | diarrhea | 0 | somnolence | 0 | dyspnea | 0 | chest pain | 0 | cerebral infarction | 0 | bundle branch block | 0 | aneurysm | 0 | angina pectoris | 0 | angioedema | 0 | anxiety | 0 | aphasia | 0 | apnea | 0 | arrhythmia | 0 | asthma | 0 | bronchospasm | 0 | ecchymosis | 0 | edema | 0 | hemorrhage | 0 | hypersensitivity | 0 | hypertension | 0 | hypotension | 0 | nephropathy | 0 | myocardial infarction | 0 | nasal congestion | 0 | nausea | 0 | neutropenia | 0 | hemiplegia | 0 | hemiparesis | 0 | hematuria | 0 | rash | 0 | fever | 0 | flushing | 0 | hallucinations | 0 | headache | 0 | cardiac arrest | 0 | heart block | 0 | congestive heart failure | 0 | hematoma | 0 | nystagmus | 0 |
|
---|