Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Methylenebutyrylphenoxyacetic acid
PubChem ID:3278
Pathway:Show KEGG pathways
InChI:InChI=1/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17)/f/h16H
SMILES:CCC(=C)C(c1ccc(c(c1Cl)Cl)OCC(O)=O)=O

Properties:
Formula:C13H12Cl2O4Atoms:19
Molecular Weight:303.138Rotatable Bonds:6
H-bond Acceptors:4H-bond Donors:0
logP:3.6057
Targets:
Synonyms:
(2,3-Dichloro-4-(2-ethylacryloyl)phenoxy)acetic acid
(2,3-Dichloro-4-(2-methylene-1-oxobutyl)phenoxy)acetic acid
(2,3-Dichloro-4-(2-methylenebutyryl)phenoxy)acetic acid
(2,3-Dichloro-4-[2-methylenebutyryl]phenoxy)acetic acid
(4-(2-Methylenebutyryl)-2,3-dichlorophenoxy)acetic acid
1gsf
2, 3-Dichloro-4-(2-methylenebutyl)phenoxyacetic acid
2, 3-Dichloro-4-(2-methylenebutyryl)phenoxyacetic acid
2,3-Dichloro-4(2-methylene- butyryl)phenoxy] acetic acid
2,3-Dichloro-4-(2-methylenebutyl)phenoxyacetic acid
2,3-Dichloro-4-(2-methylenebutyryl)phenoxy acetic acid
2,3-Dichloro-4-(2-methylenebutyryl)phenoxyacetic acid
2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid
2gss
58-54-8
6500-81-8
6500-81-8 (hydrochloride salt)
AB00051988
AC1L1FKN
Acetic acid, (2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy)-
Acetic acid, (2,3-dichloro-4-(2-methylenebutyryl)phenoxy)-
Acetic acid, [2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy]-
Acetic acid, [2,3-dichloro-4-(2-methylenebutyryl)phenoxy]-
Acetic acid, {[2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy]-}
Acetic acid, {[2,3-dichloro-4-(2-methylenebutyryl)phenoxy]-}
Acide etacrynique
Acide etacrynique [INN-French]
Acido etacrinico
Acido etacrinico [INN-Spanish]
Acidum etacrynicum
Acidum etacrynicum [INN-Latin]
AIDS-159968
AIDS159968
AKOS003404732
bmse000134
BPBio1_000086
BRD-K63630713-001-05-0
BRN 1915060
BSPBio_000078
BSPBio_002010
C13H12Cl2O4
CAS-58-54-8
CCG-38915
CCRIS 4638
CHEBI:4876
CHEMBL456
CPD000058600
Crinuryl
D00313
DB00903
DivK1c_000900
E0526
E4754_FLUKA
E4754_SIGMA
EAA
Edecril
Edecrin
Edecrina
EINECS 200-384-1
Endecril
Etacrinic acid
Etacrynic acid
Etacrynic acid (JP15/INN)
Etacrynic acid (JP16/INN)
Etakrinic acid
Ethacrinic Acid
Ethacrinique (acide)
Ethacryinic Acid
Ethacrynate
Ethacrynic Acid
Ethacrynic acid (USP)
Ethacrynic acid [USAN:BAN]
Ethacrynic Acid, Sodium Salt
Hidromedin
HMS1568D20
HMS1920M16
HMS2089N17
HMS2091D17
HMS2095D20
HMS3259G03
HMS502M22
HSDB 2136
Hydromedin
IDI1_000900
KBio1_000900
KBio2_001293
KBio2_003861
KBio2_006429
KBio3_001230
KBioGR_001207
KBioSS_001293
Kyselina 4-(2-(1-butenyl)karbonyl)-2,3-dichlorfenoxyoctova
Kyselina 4-(2-(1-butenyl)karbonyl)-2,3-dichlorfenoxyoctova [Czech]
Kyselina ethakrynova
Kyselina ethakrynova [Czech]
LS-240
Methylenebutyryl phenoxyacetic acid
Methylenebutyrylphenoxyacetic acid
Mingit
MK 595
MK-595
MLS000069535
MLS002701928
NCGC00016260-01
NCGC00016260-02
NCGC00016260-03
NCGC00016260-04
NCGC00016260-05
NCGC00016260-06
NCGC00016260-07
NCGC00016260-08
NCGC00016260-09
NCGC00016260-10
NCGC00016260-11
NCGC00022601-03
NCGC00022601-04
NCGC00022601-05
NCI60_041898
NINDS_000900
NSC 624008
NSC 85791
NSC624008
NSC85791
Otacril
Prestwick0_000259
Prestwick1_000259
Prestwick2_000259
Prestwick3_000259
Prestwick_671
Reomax
SAM002264611
SBB064161
SMR000058600
SPBio_000054
SPBio_002297
SPECTRUM1500287
Spectrum2_000097
Spectrum3_000425
Spectrum4_000544
Spectrum5_000680
Spectrum_000813
Taladren
UNII-M5DP350VZV
Uregit
WLN: QV1OR BG CG DVY2&U1
[2,3-Dichloro-4-(2-methylene-1-oxobutyl)phenoxy]acetic acid
[2,3-dichloro-4-(2-methylenebutanoyl)phenoxy]acetic acid
[2,3-Dichloro-4-(2-methylenebutyryl)phenoxy]acetic acid
[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid
[4-(2-Methylenebutyryl)-2,3-dichlorophenoxy]acetic acid
{[2,3-Dichloro-4-(2-methylene-1-oxobutyl)phenoxy]acetic} acid
{[2,} 3-Dichloro-4-(2-methylenebutyryl)phenoxy\]acetic acid
{[2,} 3-dichloro-4-(2-methylenebutyryl)phenoxy]acetic acid
{[4-(2-Methylenebutyryl)-2,3-dichlorophenoxy]acetic} acid
ATC-Codes:
Side-Effects:
Side-EffectFrequency
gout0
fatigue0
liver function tests abnormal0
convulsions0
vertigo0
diarrhea0
tinnitus0
vomiting0
gastrointestinal hemorrhage0
pain0
dysphagia0
nausea0
anorexia0
malaise0
headache0
agranulocytosis0
hypoglycemia0
hyperuricemia0
rash0
acute pancreatitis0
jaundice0
rheumatic carditis0
deafness0
hematuria0
fever0
blurred vision0
chills0
purpura0
thrombocytopenia0
confusion0
hyperglycemia0
neutropenia0
apprehension0