Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:Bis-huperzine B 5b
PubChem ID:23645103
Pathway:Show KEGG pathways
InChI:InChI=1S/C41H54N6O4/c1-26-18-28-20-34-32(10-12-36(48)42-34)40(22-26)30(28)8-5-16-46(40)38(50)24-44(3)14-7-15-45(4)25-39(51)47-17-6-9-31-29-19-27(2)23-41(31,47)33-11-13-37(49)43-35(33)21-29/h10-13,18-19,28-31H,5-9,14-17,20-25H2,1-4H3,(H,42,48)(H,43,49)/t28?,29?,30?,31?,40-,41-/m1/s1
SMILES:CN(CC(=O)N1CCC[C@H]2[C@]31CC(=CC2Cc1c3ccc(=O)[nH]1)C)CCCN(CC(=O)N1CCC[C@H]2[C@]31CC(=CC2Cc1c3ccc(=O)[nH]1)C)C

Properties:
Formula:C41H54N6O4Atoms:51
Molecular Weight:694.905Rotatable Bonds:10
H-bond Acceptors:8H-bond Donors:2
logP:3.8053
Targets:
NameUniprot IDSourceReferencesInteraction
AcetylcholinesteraseACES_RATBindingDB-shows
Synonyms:
()-oxazepam hemisuccinate sodium salt
Bis(9)-Huperzine B
Bis-huperzine B 5b
CHEMBL367977