Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:D-Glutaminsaeure
PubChem ID:23327
Pathway:-
InChI:InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1/f/h7,9H
SMILES:C(CC(O)=O)[C@H](C(O)=O)N

Properties:
Formula:C5H9NO4Atoms:11
Molecular Weight:147.129Rotatable Bonds:4
H-bond Acceptors:5H-bond Donors:0
logP:-0.0366
Targets:
Synonyms:
(2R)-2-aminopentanedioic acid
(R)-2-Aminoglutaric acid
(R)-2-Aminoglutaric acid;(R)-2-Aminopentanedioic
(R)-2-aminopentanedioic acid
138-15-8
6893-26-1
AB1001986
AC-12250
AC1L2M41
AI3-09072
Biomol-NT_000169
BPBio1_001130
C00217
CHEBI:15966
CHEMBL76232
D-2-Aminoglutaric acid
D-2-Aminopentanedioic acid
D-Glu
D-Glutamate
D-Glutamic acid
D-Glutaminic acid
D-Glutaminsaeure
D-[14C]Glu
DGL
EINECS 230-000-8
G0057
G1001_SIGMA
GLU
glutamic acid
Glutamic acid D-form
H-D-Glu-OH
L-(+)-Glutamic acid
L-Glutamic acid
Lopac-G-2128
MolPort-002-499-418
NCGC00015470-01
NCGC00024501-01
NCGC00024501-02
NCGC00024501-03
nchembio.145-comp28
nchembio.586-comp11
NSC 77686
PDSP1_000131
PDSP1_001486
PDSP2_000130
PDSP2_001470
R-(-)-1-Aminopropane-1,3-dicarboxylic acid
R-(-)-Glutamic acid
SBB006707
ST075000
TL806175
Tocris-0217