Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:ampa
PubChem ID:1221
Pathway:Show KEGG pathways
InChI:InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12)
SMILES:OC(=O)C(Cc1c(C)o[nH]c1=O)N

Properties:
Formula:C7H10N2O4Atoms:13
Molecular Weight:186.165Rotatable Bonds:3
H-bond Acceptors:5H-bond Donors:3
logP:-0.069
Targets:
Synonyms:
()-oxazepam hemisuccinate sodium salt
(+-)-alpha-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid
(+/-)-alpha-AMINO-3-HYDROXY-5-METHYL-4-ISOXAZOLEPROPIONIC ACID
(+/-)-alpha-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid hydrate
(+/-)-AMPA
(R,S)-alpha-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid
(R,S)-AMPA
1-Aminomethylphosphonic acid
110592-37-5
126632-03-9
133481-32-0
139261-99-7
139559-02-7
2-amino-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid
4-Isoxazolepropanoic acid, alpha-amino-2,3-dihydro-5-methyl-3-oxo-
74341-63-2
77521-29-0
78729-80-3
79697-77-1
81323-87-7
83354-19-2
85506-19-0
86495-63-8
92614-50-1
A6816_SIGMA
AC1L1AZQ
AC1Q2EZ4
alpha-Amino-2,3-dihydro-5-methyl-3-oxo-4-isoxazolepropanoic acid
alpha-Amino-2,3-dihydro-5-methyl-3-oxoisoxazolepropionic acid
alpha-AMINO-3-HYDROXY-5-METHYL-4-ISOXAZOLEPROPIONIC ACID
aminomethylphosphonic acid
AMPA
AMPA (pharmaceutical)
AMPA hydrobromide
C13672
C7H10N2O4
CCG-204670
CHEBI:111595
CHEMBL13378
D,L-alpha-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
DB02057
dl-alpha-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
gamma-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
IN1536
L000026
Lopac0_000581
LS-177371
M01253
MolPort-001-759-109
NCGC00015458-05
NCGC00024481-03
OR1150T
PDSP1_001835
PDSP2_001818
ST50405212
ST5405212