Home
Drugs
Targets
Pathways
Ontologies
Cyp450s
Adv.search
Help/FAQ

Drug Details

add
Name:6-Deoxyerythronolide B
PubChem ID:121904
Pathway:Show KEGG pathways
InChI:InChI=1/C21H38O6/c1-8-16-12(4)19(24)13(5)17(22)10(2)9-11(3)18(23)14(6)20(25)15(7)21(26)27-16/h10-16,18-20,23-25H,8-9H2,1-7H3/t10-,11+,12+,13+,14-,15-,16-,18+,19+,20+/m1/s1
SMILES:CC[C@@H]1([C@@H](C)[C@H]([C@H](C)C([C@H](C)(C[C@@H](C)[C@H]([C@H](C)[C@H]([C@H](C)C(=O)O1)O)O))=O)O)

Properties:
Formula:C21H38O6Atoms:37
Molecular Weight:386.523Rotatable Bonds:1
H-bond Acceptors:6H-bond Donors:0
logP:2.1803
Targets:
NameUniprot IDSourceReferencesInteraction
6-deoxyerythronolide B hydroxylaseCPXJ_SACENDrugBank-shows
Synonyms:
(3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-ethyl-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyloxacyclotetradecane-2,10-dione
15797-36-1
3,5,11-Trihydroxyerythranolid-9-one
6,12-Dideoxy-erythronolide A
6-Deoxyerythronolide B
C03240
CHEBI:16089
CPD-428
DEB
Erythronolide A, 6,12-dideoxy-
LMPK04000002
nchembio824-comp8
oxacyclotetradecane-2,10-dione,